Compound Q&A

What are the physical and chemical properties of Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

Answer

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is a crystalline solid with a molecular weight of approximately 634.64 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and chloroform. This compound is known for its reactivity, particularly in nucleophilic substitution reactions. It is also stable under normal conditions but should be stored in airtight containers to prevent moisture absorption.

About

CAS No 68156-13-8
English Name Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
Molecular Formula C24H19F6PS2
Molecular Weight 516.5 g/mol
EINECS 269-006-0
SMILES C1=CC=C(SC2=CC=CC=C2[S+](C2=CC=CC=C2)C2=CC=CC=C2)C=C1.F[P-](F)(F)(F)(F)F
InChIKey SFWSATMGMAKCIF-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8) typically synthesized?

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is typically synthesized via a multi-step p...

Compound Q&A

What industries use Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

When handling Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...