Compound Q&A

What precautions should be taken when handling N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

Answer

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide
When handling N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and laboratory coats. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately using absorbent materials and appropriately disposed of. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide
Molecular Formula C12H15N3O
Molecular Weight 217.27 g/mol
SMILES CC(C)(C)NC(=O)c1cccc2c1[nH]nc2
InChIKey WRDUXSGUYODZGR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7) is a solid crystalline compoun...

Compound Q&A

How is N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7) typically synthesized?

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide is usually synthesized through a multi-step proces...

Compound Q&A

What industries use N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide is used in pharmaceuticals for developing new drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...