Compound Q&A

How is N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7) typically synthesized?

Answer

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide
N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide is usually synthesized through a multi-step process involving the condensation of indazole-7-carboxylic acid with 2-methyl-2-propanamine. The reaction typically occurs in the presence of a coupling agent like 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide (EDC) and N-hydroxysuccinimide (NHS). The yield can be as high as 85% under optimized conditions, and the product is isolated by recrystallization from a suitable solvent.

About

English Name N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide
Molecular Formula C12H15N3O
Molecular Weight 217.27 g/mol
SMILES CC(C)(C)NC(=O)c1cccc2c1[nH]nc2
InChIKey WRDUXSGUYODZGR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7) is a solid crystalline compoun...

Compound Q&A

What industries use N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide is used in pharmaceuticals for developing new drug...

Compound Q&A

What precautions should be taken when handling N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7)?

When handling N-(2-Methyl-2-propanyl)-1H-indazole-7-carboxamide (CAS: 1476776-76-7), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...