Compound Q&A

What industries use 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

Answer

1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane
1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is used in the pharmaceutical industry for drug synthesis, in polymer science for fluorinated polymer modification, in semiconductor manufacturing for etching processes, and in analytical chemistry for detection and measurement applications.

About

CAS No 375-48-4
English Name 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane
Molecular Formula C4BrF9
Molecular Weight 298.93 g/mol
SMILES C(C(C(F)(F)Br)(F)F)(C(F)(F)F)(F)F
InChIKey CVEIKEYTQKDDQK-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is a colorless, highly fluorinated liquid with a molecula...

Compound Q&A

How is 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4) typically synthesized?

1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is typically synthesized via the reaction of 1,1,2,2,3,3,...

Compound Q&A

What precautions should be taken when handling 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

When handling 1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane, use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...