Compound Q&A

What are the physical and chemical properties of 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

Answer

1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane
1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is a colorless, highly fluorinated liquid with a molecular weight of 431.9 g/mol. It has low solubility in water but good solubility in organic solvents. The compound is relatively inert chemically but can react under certain conditions to form bromides. It exists as a solid at room temperature and melts at -27.8°C.

About

CAS No 375-48-4
English Name 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane
Molecular Formula C4BrF9
Molecular Weight 298.93 g/mol
SMILES C(C(C(F)(F)Br)(F)F)(C(F)(F)F)(F)F
InChIKey CVEIKEYTQKDDQK-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4) typically synthesized?

1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is typically synthesized via the reaction of 1,1,2,2,3,3,...

Compound Q&A

What industries use 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane is used in the pharmaceutical industry for drug synthesis...

Compound Q&A

What precautions should be taken when handling 1-Bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS: 375-48-4)?

When handling 1-Bromo-1,1,2,2,3,3,4,4,4-Nonafluorobutane, use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...