Compound Q&A

What industries use Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Answer

Dipotassium methanedisulfonate
Dipotassium methanedisulfonate finds applications in the pharmaceutical industry for the production of certain salts and intermediates. It is also utilized in the polymer industry for the synthesis of special polymers. Additionally, it is used in the semiconductor industry for etching processes and in sensors for its unique reactivity.

About

CAS No 6291-65-2
English Name Dipotassium methanedisulfonate
Molecular Formula CH2K2O6S2
Molecular Weight 252.35 g/mol
SMILES C(S(=O)(=O)[O-])S(=O)(=O)[O-].[K+].[K+]
InChIKey JSXPCVUETJIQHE-UHFFFAOYSA-L
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Dipotassium methanedisulfonate is a crystalline compound with a molecular weight of approximately 18...

Compound Q&A

How is Dipotassium methanedisulfonate (CAS: 6291-65-2) typically synthesized?

Dipotassium methanedisulfonate is commonly synthesized by the reaction of potassium hydroxide with m...

Compound Q&A

What precautions should be taken when handling Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Proper handling of Dipotassium methanedisulfonate requires wearing personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...