Compound Q&A

How is Dipotassium methanedisulfonate (CAS: 6291-65-2) typically synthesized?

Answer

Dipotassium methanedisulfonate
Dipotassium methanedisulfonate is commonly synthesized by the reaction of potassium hydroxide with methanedisulfonic acid. The synthesis involves using a strong base catalyst and typically results in a high yield and good selectivity. The process is carried out in water at room temperature, ensuring safety and efficiency.

About

CAS No 6291-65-2
English Name Dipotassium methanedisulfonate
Molecular Formula CH2K2O6S2
Molecular Weight 252.35 g/mol
SMILES C(S(=O)(=O)[O-])S(=O)(=O)[O-].[K+].[K+]
InChIKey JSXPCVUETJIQHE-UHFFFAOYSA-L
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Dipotassium methanedisulfonate is a crystalline compound with a molecular weight of approximately 18...

Compound Q&A

What industries use Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Dipotassium methanedisulfonate finds applications in the pharmaceutical industry for the production ...

Compound Q&A

What precautions should be taken when handling Dipotassium methanedisulfonate (CAS: 6291-65-2)?

Proper handling of Dipotassium methanedisulfonate requires wearing personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...