Compound Q&A

What industries use 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

Answer

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate
4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) is used in various industries, particularly in the pharmaceutical sector for drug synthesis, and in the development of sensors and semiconductors. It is also utilized in the production of polymers due to its functional groups.

About

CAS No 30578-37-1
English Name 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate
Molecular Formula C12H15N3O5S
Molecular Weight 313.33 g/mol
SMILES COC1=[N+](N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)[O-]
InChIKey ZEASXVYVFFXULL-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) is a crystalline solid wi...

Compound Q&A

How is 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) typically synthesized?

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate is typically synthesized via a multi-step p...

Compound Q&A

What precautions should be taken when handling 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

When handling 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...