Compound Q&A

How is 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) typically synthesized?

Answer

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate
4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate is typically synthesized via a multi-step process involving the coupling of a phenylamine derivative with a methoxy pyridazine followed by methylation and sulfate esterification. The reaction conditions include the use of appropriate solvents and catalysts to achieve high selectivity and yield.

About

CAS No 30578-37-1
English Name 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate
Molecular Formula C12H15N3O5S
Molecular Weight 313.33 g/mol
SMILES COC1=[N+](N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)[O-]
InChIKey ZEASXVYVFFXULL-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) is a crystalline solid wi...

Compound Q&A

What industries use 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1) is used in various indust...

Compound Q&A

What precautions should be taken when handling 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1)?

When handling 4-Amino-6-methoxy-1-phenylpyridazin-1-ium methyl sulfate (CAS: 30578-37-1), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...