Compound Q&A

What industries use Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

Answer

Bis(trifluoroacetato-kappaO)copper hydrate (1:1)
Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is used in the pharmaceutical industry for the synthesis of certain organic compounds and in the development of new materials. It also finds applications in polymer research and as a reagent in analytical chemistry.

About

English Name Bis(trifluoroacetato-kappaO)copper hydrate (1:1)
Molecular Formula C4H2CuF6O5
Molecular Weight 307.59 g/mol
SMILES C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Cu+2]
InChIKey SFAIGHZDVQCLIO-UHFFFAOYSA-L
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is a crystalline compound with a molec...

Compound Q&A

How is Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) typically synthesized?

Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is synthesized by the reaction of copp...

Compound Q&A

What precautions should be taken when handling Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

When handling Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...