Compound Q&A

What are the physical and chemical properties of Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

Answer

Bis(trifluoroacetato-kappaO)copper hydrate (1:1)
Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is a crystalline compound with a molecular weight of approximately 346.2 g/mol. It has a low solubility in water and is moderately soluble in organic solvents. The compound exhibits limited reactivity, typically only reacting with strong bases or reducing agents under controlled conditions.

About

English Name Bis(trifluoroacetato-kappaO)copper hydrate (1:1)
Molecular Formula C4H2CuF6O5
Molecular Weight 307.59 g/mol
SMILES C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Cu+2]
InChIKey SFAIGHZDVQCLIO-UHFFFAOYSA-L
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) typically synthesized?

Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is synthesized by the reaction of copp...

Compound Q&A

What industries use Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0)?

When handling Bis(trifluoroacetato-kappaO)copper hydrate (CAS: 123333-88-0), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...