Compound Q&A

What industries use Tocopherols (Technical Grade) (CAS: 1406-66-2)?

Answer

Tocopherols (Technical Grade)
Tocopherols (Technical Grade) (CAS: 1406-66-2) are widely used in the pharmaceutical and food industries for their antioxidant properties. They are also used in cosmetic products and as vitamin E supplements. Additionally, they find applications in polymer stabilizers, vitamin manufacturing, and as antioxidants in food and pharmaceutical formulations.

About

CAS No 1406-66-2
English Name Tocopherols (Technical Grade)
Molecular Formula C28H48O2
Molecular Weight 416.7 g/mol
SMILES CC1=C(C=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)O
InChIKey QUEDXNHFTDJVIY-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tocopherols (Technical Grade) (CAS: 1406-66-2)?

Tocopherols (Technical Grade) (CAS: 1406-66-2) are solid waxy materials with a molecular weight rang...

Compound Q&A

How is Tocopherol (Technical Grade) (CAS: 1406-66-2) typically synthesized?

Tocopherol (Technical Grade) (CAS: 1406-66-2) is typically synthesized through the reduction of caff...

Compound Q&A

What precautions should be taken when handling Tocopherols (Technical Grade) (CAS: 1406-66-2)?

When handling Tocopherols (Technical Grade) (CAS: 1406-66-2), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...