Compound Q&A

How is Tocopherol (Technical Grade) (CAS: 1406-66-2) typically synthesized?

Answer

Tocopherols (Technical Grade)
Tocopherol (Technical Grade) (CAS: 1406-66-2) is typically synthesized through the reduction of caffeic acid or through chemical modification of plant materials. The process commonly involves hydrogenation or catalytic reduction to produce the final product with varying degrees of purity.

About

CAS No 1406-66-2
English Name Tocopherols (Technical Grade)
Molecular Formula C28H48O2
Molecular Weight 416.7 g/mol
SMILES CC1=C(C=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)O
InChIKey QUEDXNHFTDJVIY-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tocopherols (Technical Grade) (CAS: 1406-66-2)?

Tocopherols (Technical Grade) (CAS: 1406-66-2) are solid waxy materials with a molecular weight rang...

Compound Q&A

What industries use Tocopherols (Technical Grade) (CAS: 1406-66-2)?

Tocopherols (Technical Grade) (CAS: 1406-66-2) are widely used in the pharmaceutical and food indust...

Compound Q&A

What precautions should be taken when handling Tocopherols (Technical Grade) (CAS: 1406-66-2)?

When handling Tocopherols (Technical Grade) (CAS: 1406-66-2), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...