Compound Q&A

What precautions should be taken when handling 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

Answer

2-Naphthol-6-sulfonic acid
When handling 2-Naphthol-6-sulfonic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be carried out in a well-ventilated area or a fume hood to prevent inhalation of the compound. Spills should be handled with caution using appropriate absorbent materials, and the material safety data sheet (MSDS) should be consulted for detailed spill cleanup procedures.

About

CAS No 93-01-6
English Name 2-Naphthol-6-sulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.24 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1O
InChIKey VVPHSMHEYVOVLH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

2-Naphthol-6-sulfonic acid is a white crystalline solid with a molecular weight of approximately 216...

Compound Q&A

How is 2-Naphthol-6-sulfonic acid (CAS: 93-01-6) typically synthesized?

2-Naphthol-6-sulfonic acid is typically synthesized by the sulfonation of 2-naphthol using concentra...

Compound Q&A

What industries use 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

2-Naphthol-6-sulfonic acid finds applications in various industries. It is used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...