Compound Q&A

How is 2-Naphthol-6-sulfonic acid (CAS: 93-01-6) typically synthesized?

Answer

2-Naphthol-6-sulfonic acid
2-Naphthol-6-sulfonic acid is typically synthesized by the sulfonation of 2-naphthol using concentrated sulfuric acid. The reaction is carried out at high temperatures, and the use of a sulfonation catalyst like iron(III) sulfate can improve the yield and selectivity. The product is purified by recrystallization from water.

About

CAS No 93-01-6
English Name 2-Naphthol-6-sulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.24 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1O
InChIKey VVPHSMHEYVOVLH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

2-Naphthol-6-sulfonic acid is a white crystalline solid with a molecular weight of approximately 216...

Compound Q&A

What industries use 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

2-Naphthol-6-sulfonic acid finds applications in various industries. It is used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Naphthol-6-sulfonic acid (CAS: 93-01-6)?

When handling 2-Naphthol-6-sulfonic acid, it is crucial to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...