Compound Q&A

What industries use 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

Answer

7-Nitro-1H-indole-2,3-dione
7-Nitro-1H-indole-2,3-dione is primarily used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in the production of certain dyes and pigments due to its aromatic structure. Additionally, it has applications in the development of sensors and as an intermediate in the production of certain semiconductors.

About

English Name 7-Nitro-1H-indole-2,3-dione
Molecular Formula C8H4N2O4
Molecular Weight 192.13 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=O)C2=O
InChIKey GVZRFFXBGZSJTH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

7-Nitro-1H-indole-2,3-dione is a crystalline compound with a molecular weight of approximately 228.1...

Compound Q&A

How is 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8) typically synthesized?

7-Nitro-1H-indole-2,3-dione can be synthesized via the nitration of indole-2,3-dione. Common methods...

Compound Q&A

What precautions should be taken when handling 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

When handling 7-Nitro-1H-indole-2,3-dione, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...