Compound Q&A

How is 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8) typically synthesized?

Answer

7-Nitro-1H-indole-2,3-dione
7-Nitro-1H-indole-2,3-dione can be synthesized via the nitration of indole-2,3-dione. Common methods involve the use of nitric acid and sulfuric acid as the nitrating agent. The reaction is typically carried out in a solvent like glacial acetic acid, yielding a product with a high degree of purity and selectivity.

About

English Name 7-Nitro-1H-indole-2,3-dione
Molecular Formula C8H4N2O4
Molecular Weight 192.13 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=O)C2=O
InChIKey GVZRFFXBGZSJTH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

7-Nitro-1H-indole-2,3-dione is a crystalline compound with a molecular weight of approximately 228.1...

Compound Q&A

What industries use 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

7-Nitro-1H-indole-2,3-dione is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 7-Nitro-1H-indole-2,3-dione (CAS: 112656-95-8)?

When handling 7-Nitro-1H-indole-2,3-dione, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...