Compound Q&A

What are the physical and chemical properties of Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide (CAS: 127-58-2)?

Answer

Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide
Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide is a crystalline compound with a molecular weight of approximately 455.35 g/mol. It has a density of about 1.47 g/cm³ and a melting point of around 245°C. This compound is sparingly soluble in water but more soluble in organic solvents. It is known for its reactivity, particularly in nucleophilic substitution reactions.

About

CAS No 127-58-2
English Name Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide
Molecular Formula C11H11N4NaO2S
Molecular Weight 286.29 g/mol
SMILES CC1=NC(=NC=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+]
InChIKey BSFJGCCAXDCMOX-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide (CAS: 127-58-2) typically synthesized?

Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide is typically synthesized through a m...

Compound Q&A

What industries use Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide (CAS: 127-58-2)?

Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide finds applications in pharmaceutical...

Compound Q&A

What precautions should be taken when handling Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide (CAS: 127-58-2)?

When handling Sodium [(4-aminophenyl)sulfonyl](4-methyl-2-pyrimidinyl)azanide, it is crucial to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...