Compound Q&A

What industries use tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

Answer

tert-Butyl 4-bromoindoline-1-carboxylate
tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is used in the pharmaceutical industry for the synthesis of intermediates and in polymer science for improving the properties of polymers. It also has applications in the development of sensors and semiconductors due to its unique chemical structure. Its versatility makes it suitable for a range of advanced materials and technologies.

About

English Name tert-Butyl 4-bromoindoline-1-carboxylate
Molecular Formula C13H16BrNO2
Molecular Weight 298.18 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C1C=CC=C2Br
InChIKey DUZIJTYKDFFQDJ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is a crystalline solid with a molecular...

Compound Q&A

How is tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) typically synthesized?

tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is synthesized via a bromination reacti...

Compound Q&A

What precautions should be taken when handling tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

When handling tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...