Compound Q&A

How is tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) typically synthesized?

Answer

tert-Butyl 4-bromoindoline-1-carboxylate
tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is synthesized via a bromination reaction of tert-butyl indoline-1-carboxylate with N-bromosuccinimide (NBS) in the presence of AIBN (2,2'-azobisisobutyronitrile) as a radical initiator. The reaction is typically carried out under nitrogen atmosphere to avoid decomposition. The yield is generally around 70-80%.

About

English Name tert-Butyl 4-bromoindoline-1-carboxylate
Molecular Formula C13H16BrNO2
Molecular Weight 298.18 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C1C=CC=C2Br
InChIKey DUZIJTYKDFFQDJ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is a crystalline solid with a molecular...

Compound Q&A

What industries use tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8)?

When handling tert-Butyl 4-bromoindoline-1-carboxylate (CAS: 885272-46-8), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...