Compound Q&A

What industries use (6-[(Diethylamino)methyl]-2-naphthyl)methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate (CAS: 732302-99-7)?

Answer

{6-[(Diethylamino)methyl]-2-naphthyl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate
This compound is primarily used in the pharmaceutical industry for its potential as a drug intermediate. It may also be used in the polymer industry for its reactive functional groups. Its applications in the sensor and semiconductor industries are also being explored due to its unique chemical properties.

About

English Name {6-[(Diethylamino)methyl]-2-naphthyl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate
Molecular Formula C24H30ClN3O5
Molecular Weight 475.97 g/mol
SMILES CCN(CC)CC1=CC2=C(C=C1)C=C(C=C2)COC(=O)NC3=CC=C(C=C3)C(=O)NO.O.Cl
InChIKey FKGKZBBDJSKCIS-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-[(Diethylamino)methyl]-2-naphthyl)methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate (CAS: 732302-99-7)?

This compound is a crystalline solid with a molecular weight of approximately 605.75 g/mol. It is sl...

Compound Q&A

How is (6-[(Diethylamino)methyl]-2-naphthyl)methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate (CAS: 732302-99-7) typically synthesized?

The compound is synthesized through a multi-step process involving naphthalene derivatives and carba...

Compound Q&A

What precautions should be taken when handling (6-[(Diethylamino)methyl]-2-naphthyl)methyl [4-(hydroxycarbamoyl)phenyl]carbamate hydrochloride hydrate (CAS: 732302-99-7)?

Proper Personal Protective Equipment (PPE) is essential, including gloves, goggles, and a lab coat. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...