Compound Q&A

What industries use 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

Answer

2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate
This compound is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds application in the polymer industry for modifying polymer properties and in the sensor and semiconductor industries for specialized chemical functionalities.

About

English Name 2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate
Molecular Formula C13H18BrNO2
Molecular Weight 300.2 g/mol
SMILES C[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1
InChIKey KECPRZHCNCDSET-VIFPVBQESA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

The compound is a white crystalline solid with a molecular weight of approximately 328.07 g/mol. It ...

Compound Q&A

How is 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6) typically synthesized?

The compound is synthesized via the reaction of (1S)-1-(4-bromophenyl)ethanamine with 2-methyl-2-pro...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...