Compound Q&A

How is 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6) typically synthesized?

Answer

2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate
The compound is synthesized via the reaction of (1S)-1-(4-bromophenyl)ethanamine with 2-methyl-2-propanoyl isocyanate. The process involves a nucleophilic substitution reaction and typically yields up to 85% of the desired product with good selectivity.

About

English Name 2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate
Molecular Formula C13H18BrNO2
Molecular Weight 300.2 g/mol
SMILES C[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1
InChIKey KECPRZHCNCDSET-VIFPVBQESA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

The compound is a white crystalline solid with a molecular weight of approximately 328.07 g/mol. It ...

Compound Q&A

What industries use 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

This compound is primarily used in the pharmaceutical industry for the synthesis of drug intermediat...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl [(1S)-1-(4-bromophenyl)ethyl]carbamate (CAS: 847728-89-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...