Compound Q&A

What industries use (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

Answer

(3beta)-3-Hydroxychol-5-en-24-oic acid
(3beta)-3-Hydroxychol-5-en-24-oic acid is utilized in the pharmaceutical industry for the development of cholesterol-related drugs. It is also used in the polymer industry for the modification of polymer properties and in semiconductor technology for research purposes. Additionally, it has potential applications in the sensor industry for the development of biosensors.

About

CAS No 5255-17-4
English Name (3beta)-3-Hydroxychol-5-en-24-oic acid
Molecular Formula C24H38O3
Molecular Weight 374.57 g/mol
SMILES CC(CCC(=O)O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
InChIKey HIAJCGFYHIANNA-QIZZZRFXSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

(3beta)-3-Hydroxychol-5-en-24-oic acid is a solid at room temperature with a molecular weight of app...

Compound Q&A

How is (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4) typically synthesized?

(3beta)-3-Hydroxychol-5-en-24-oic acid is usually synthesized via reduction of 24-oxochol-5-en-3-one...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

When handling (3beta)-3-Hydroxychol-5-en-24-oic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...