Compound Q&A

How is (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4) typically synthesized?

Answer

(3beta)-3-Hydroxychol-5-en-24-oic acid
(3beta)-3-Hydroxychol-5-en-24-oic acid is usually synthesized via reduction of 24-oxochol-5-en-3-one with sodium borohydride followed by hydrolysis under basic conditions. The reaction is highly selective and yields up to 90% of the desired product. The process requires careful control of pH and temperature to achieve high purity.

About

CAS No 5255-17-4
English Name (3beta)-3-Hydroxychol-5-en-24-oic acid
Molecular Formula C24H38O3
Molecular Weight 374.57 g/mol
SMILES CC(CCC(=O)O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
InChIKey HIAJCGFYHIANNA-QIZZZRFXSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

(3beta)-3-Hydroxychol-5-en-24-oic acid is a solid at room temperature with a molecular weight of app...

Compound Q&A

What industries use (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

(3beta)-3-Hydroxychol-5-en-24-oic acid is utilized in the pharmaceutical industry for the developmen...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxychol-5-en-24-oic acid (CAS: 5255-17-4)?

When handling (3beta)-3-Hydroxychol-5-en-24-oic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...