Compound Q&A

What are the physical and chemical properties of 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol (CAS: 368-63-8)?

Answer

1-(3,5-Bis(trifluoromethyl)phenyl)ethanol
1-(3,5-Bis(trifluoromethyl)phenyl)ethanol is a colorless liquid with a high boiling point and low water solubility. It has a molecular weight of 322.14 g/mol and is poorly soluble in water but soluble in organic solvents. It is highly reactive towards nucleophiles and electrophiles, making it suitable for various synthetic transformations. Its physical properties include a density of 1.41 g/cm³ and a boiling point of 262 °C (decomposition).

About

CAS No 368-63-8
English Name 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol
Molecular Formula C10H8F6O
Molecular Weight 258.16 g/mol
SMILES CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O
InChIKey MMSCIQKQJVBPIR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol (CAS: 368-63-8) typically synthesized?

1-(3,5-Bis(trifluoromethyl)phenyl)ethanol can be synthesized via a trifluoromethylation reaction of ...

Compound Q&A

What industries use 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol (CAS: 368-63-8)?

1-(3,5-Bis(trifluoromethyl)phenyl)ethanol is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol (CAS: 368-63-8)?

When handling 1-(3,5-Bis(trifluoromethyl)phenyl)ethanol, safety is paramount due to its volatility a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...