Compound Q&A

What industries use Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

Answer

Acetyl tetrapeptide-15
Acetyl tetrapeptide-15 (CAS: 928007-64-1) is primarily used in the cosmetics and pharmaceutical industries. It is an effective moisturizing and anti-aging agent, making it popular in skin care products and formulations. Additionally, it is used in some medical treatments for skin conditions.

About

English Name Acetyl tetrapeptide-15
Molecular Formula C34H39N5O6
Molecular Weight 613.72 g/mol
SMILES CC(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)NC(CC4=CC=CC=C4)C(=O)N
InChIKey BSXFOBDOGHFWOC-KRCBVYEFSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

Acetyl tetrapeptide-15 is a crystalline compound with a molecular weight of approximately 514.5 g/mo...

Compound Q&A

How is Acetyl tetrapeptide-15 (CAS: 928007-64-1) typically synthesized?

Acetyl tetrapeptide-15 is synthesized through solid-phase peptide synthesis (SPPS) using standard Fm...

Compound Q&A

What precautions should be taken when handling Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

When handling Acetyl tetrapeptide-15 (CAS: 928007-64-1), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...