Compound Q&A

What are the physical and chemical properties of Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

Answer

Acetyl tetrapeptide-15
Acetyl tetrapeptide-15 is a crystalline compound with a molecular weight of approximately 514.5 g/mol. It is moderately soluble in water and ethanol. This peptide is stable under normal conditions but can degrade under acidic or alkaline conditions. It is used in cosmetics and pharmaceuticals due to its moisturizing and anti-aging properties.

About

English Name Acetyl tetrapeptide-15
Molecular Formula C34H39N5O6
Molecular Weight 613.72 g/mol
SMILES CC(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)NC(CC4=CC=CC=C4)C(=O)N
InChIKey BSXFOBDOGHFWOC-KRCBVYEFSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Acetyl tetrapeptide-15 (CAS: 928007-64-1) typically synthesized?

Acetyl tetrapeptide-15 is synthesized through solid-phase peptide synthesis (SPPS) using standard Fm...

Compound Q&A

What industries use Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

Acetyl tetrapeptide-15 (CAS: 928007-64-1) is primarily used in the cosmetics and pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Acetyl tetrapeptide-15 (CAS: 928007-64-1)?

When handling Acetyl tetrapeptide-15 (CAS: 928007-64-1), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...