Compound Q&A

What industries use 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

Answer

4-Chlorophenyl phosphorodichloridate
4-Chlorophenyl phosphorodichloridate is used in various industries, including pharmaceuticals for the synthesis of new drugs, and in the production of organic phosphorus compounds. It also finds applications in the synthesis of pesticides, herbicides, and in the preparation of certain polymers and sensors.

About

CAS No 772-79-2
English Name 4-Chlorophenyl phosphorodichloridate
Molecular Formula C6H4Cl3O2P
Molecular Weight 245.43 g/mol
SMILES C1=CC(=CC=C1OP(=O)(Cl)Cl)Cl
InChIKey CCZMQYGSXWZFKI-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

4-Chlorophenyl phosphorodichloridate is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2) typically synthesized?

4-Chlorophenyl phosphorodichloridate is typically synthesized by treating 4-chlorophenyl phosphate w...

Compound Q&A

What precautions should be taken when handling 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

Precautions when handling 4-Chlorophenyl phosphorodichloridate include the use of personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...