Compound Q&A

How is 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2) typically synthesized?

Answer

4-Chlorophenyl phosphorodichloridate
4-Chlorophenyl phosphorodichloridate is typically synthesized by treating 4-chlorophenyl phosphate with hydrochloric acid. The reaction is carried out in a solvent such as methylene chloride or dichloromethane, and the product is isolated by filtration. The yield is usually around 85-90%.

About

CAS No 772-79-2
English Name 4-Chlorophenyl phosphorodichloridate
Molecular Formula C6H4Cl3O2P
Molecular Weight 245.43 g/mol
SMILES C1=CC(=CC=C1OP(=O)(Cl)Cl)Cl
InChIKey CCZMQYGSXWZFKI-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

4-Chlorophenyl phosphorodichloridate is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

4-Chlorophenyl phosphorodichloridate is used in various industries, including pharmaceuticals for th...

Compound Q&A

What precautions should be taken when handling 4-Chlorophenyl phosphorodichloridate (CAS: 772-79-2)?

Precautions when handling 4-Chlorophenyl phosphorodichloridate include the use of personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...