Compound Q&A

What are the main uses of Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4)?

Answer

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate
Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is primarily used in pharmaceuticals for its antioxidant properties and in research for its ability to form stable complexes. It has potential applications in the synthesis of other compounds and as a reagent in various chemical reactions.

About

CAS No 52207-48-4
English Name Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate
Molecular Formula C5H11NNa2O6S4
Molecular Weight 355.38 g/mol
SMILES CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)[O-].[Na+].[Na+]
InChIKey QSOHVSNIQHGFJU-UHFFFAOYSA-L
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4)?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is a chemical c...

Compound Q&A

Is Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) safe?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is generally co...

Compound Q&A

How should Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) be stored?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) should be store...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...