Compound Q&A

What is Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4)?

Answer

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate
Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is a chemical compound with a unique structure that includes disulfide and sulfurothioate functionalities. It is characterized by its ability to form stable complexes and is often used in various applications due to its unique reactivity.

About

CAS No 52207-48-4
English Name Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate
Molecular Formula C5H11NNa2O6S4
Molecular Weight 355.38 g/mol
SMILES CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)[O-].[Na+].[Na+]
InChIKey QSOHVSNIQHGFJU-UHFFFAOYSA-L
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What are the main uses of Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4)?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is primarily us...

Compound Q&A

Is Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) safe?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) is generally co...

Compound Q&A

How should Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) be stored?

Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate (CAS: 52207-48-4) should be store...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...