Compound Q&A

Is [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) safe?

Answer

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid
[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is generally considered safe when handled with proper precautions. Users should avoid inhalation and skin contact, and wear appropriate personal protective equipment such as gloves and goggles. Ensure good ventilation and store away from heat and direct sunlight.

About

English Name [3-chloro-4-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BClF3O2
Molecular Weight 224.37 g/mol
SMILES OB(O)c1ccc(c(Cl)c1)C(F)(F)F
InChIKey OCHKTAGGJMWISO-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1)?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is a chemical compound with a mo...

Compound Q&A

What are the main uses of [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1)?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is primarily used as a reagent i...

Compound Q&A

How should [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) be stored?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) should be stored in a cool, dry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...