Compound Q&A

What are the main uses of [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1)?

Answer

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid
[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is primarily used as a reagent in organic synthesis, especially in the Suzuki-Miyaura coupling reaction, which is crucial for the preparation of complex organic molecules in pharmaceutical and material science industries.

About

English Name [3-chloro-4-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BClF3O2
Molecular Weight 224.37 g/mol
SMILES OB(O)c1ccc(c(Cl)c1)C(F)(F)F
InChIKey OCHKTAGGJMWISO-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1)?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is a chemical compound with a mo...

Compound Q&A

Is [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) safe?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) is generally considered safe whe...

Compound Q&A

How should [3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) be stored?

[3-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 847756-88-1) should be stored in a cool, dry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...