Compound Q&A

How should 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0) be stored?

Answer

4-(1H-1,2,4-Triazol-1-yl)benzoic acid
4-(1H-1,2,4-Triazol-1-yl)benzoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture absorption. Store it at room temperature (15-25°C) and protect it from humidity to maintain its stability. Avoid storing it near incompatible materials such as strong acids or reducing agents.

About

English Name 4-(1H-1,2,4-Triazol-1-yl)benzoic acid
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1C(=O)O)N2C=NC=N2
InChIKey FOMQQGKCPYKKHQ-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0)?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid, also known as 4-(1H-1,2,4-triazol-1-yl)benzoic acid, is a com...

Compound Q&A

What are the main uses of 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0)?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid is primarily used in the pharmaceutical industry for its antim...

Compound Q&A

Is 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0) safe?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid is generally considered safe for use in pharmaceuticals and re...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...