Compound Q&A

What are the main uses of 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0)?

Answer

4-(1H-1,2,4-Triazol-1-yl)benzoic acid
4-(1H-1,2,4-Triazol-1-yl)benzoic acid is primarily used in the pharmaceutical industry for its antimicrobial and antifungal properties. It is also utilized in research for synthesizing other compounds and in the development of new drugs. Additionally, it can be found in some consumer products for its fungicidal and antiseptic effects.

About

English Name 4-(1H-1,2,4-Triazol-1-yl)benzoic acid
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1C(=O)O)N2C=NC=N2
InChIKey FOMQQGKCPYKKHQ-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0)?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid, also known as 4-(1H-1,2,4-triazol-1-yl)benzoic acid, is a com...

Compound Q&A

Is 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0) safe?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid is generally considered safe for use in pharmaceuticals and re...

Compound Q&A

How should 4-(1H-1,2,4-Triazol-1-yl)benzoic acid (CAS: 162848-16-0) be stored?

4-(1H-1,2,4-Triazol-1-yl)benzoic acid should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...