Compound Q&A

How should Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) be stored?

Answer

Bis(~15~N)ammonium sulfate
Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture absorption. Storage at temperatures below 25°C is ideal to maintain its stability and minimize degradation.

About

CAS No 43086-58-4
English Name Bis(~15~N)ammonium sulfate
Molecular Formula H815N2O4S
Molecular Weight 134.13 g/mol
SMILES [15NH4+].[15NH4+].[O-]S(=O)(=O)[O-]
InChIKey BFNBIHQBYMNNAN-ISOLYIDJSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is Bis(~15~N)ammonium sulfate (CAS: 43086-58-4)?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is a chemical compound that exists as a salt of sulfuri...

Compound Q&A

What are the main uses of Bis(~15~N)ammonium sulfate (CAS: 43086-58-4)?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is primarily used in pharmaceuticals as a buffer and st...

Compound Q&A

Is Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) safe?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is generally considered safe for most applications when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...