Compound Q&A

Is Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) safe?

Answer

Bis(~15~N)ammonium sulfate
Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is generally considered safe for most applications when used as directed. However, it is important to follow safety precautions, such as avoiding contact with eyes and skin, and ensuring proper ventilation during handling. Protective gloves and goggles are recommended.

About

CAS No 43086-58-4
English Name Bis(~15~N)ammonium sulfate
Molecular Formula H815N2O4S
Molecular Weight 134.13 g/mol
SMILES [15NH4+].[15NH4+].[O-]S(=O)(=O)[O-]
InChIKey BFNBIHQBYMNNAN-ISOLYIDJSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is Bis(~15~N)ammonium sulfate (CAS: 43086-58-4)?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is a chemical compound that exists as a salt of sulfuri...

Compound Q&A

What are the main uses of Bis(~15~N)ammonium sulfate (CAS: 43086-58-4)?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) is primarily used in pharmaceuticals as a buffer and st...

Compound Q&A

How should Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) be stored?

Bis(~15~N)ammonium sulfate (CAS: 43086-58-4) should be stored in a cool, dry place, away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...