Compound Q&A

What is N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4)?

Answer

N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine
N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) is a complex peptide with a molecular structure that includes amino acid residues. It has low solubility in water and is primarily used in pharmaceutical and research applications. This compound is known for its potential in drug development and biochemical studies.

About

English Name N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine
Molecular Formula C26H39N5O9
Molecular Weight 565.62 g/mol
SMILES CC(N[C@@H](CCCCN)C(N[C@@H](CC(O)=O)C(N[C@@H](C(C)C)C(N[C@@H](CC1=CC=C(O)C=C1)C(O)=O)=O)=O)=O)=O
InChIKey ITIMHIATVYROGF-XWUOBKMESA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What are the main uses of N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4)?

N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) is mainly used in pharmac...

Compound Q&A

Is N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) safe?

N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) is considered safe for la...

Compound Q&A

How should N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) be stored?

N~2~-Acetyl-L-lysyl-L-alpha-aspartyl-L-valyl-L-tyrosine (CAS: 757942-88-4) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...