Compound Q&A

How should 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) be stored?

Answer

6-Chloro-5-nitronicotinic acid
6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Proper ventilation is recommended during storage to ensure safety.

About

CAS No 7477-10-3
English Name 6-Chloro-5-nitronicotinic acid
Molecular Formula C6H3ClN2O4
Molecular Weight 202.55 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])Cl)C(=O)O
InChIKey HCRHNMXCDNACMH-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3)?

6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) is a chemical compound with the molecular formula C7...

Compound Q&A

What are the main uses of 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3)?

6-Chloro-5-nitronicotinic acid is primarily used in the pharmaceutical industry as an intermediate i...

Compound Q&A

Is 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) safe?

6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) is generally considered safe when handled with appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...