Compound Q&A

What are the main uses of 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3)?

Answer

6-Chloro-5-nitronicotinic acid
6-Chloro-5-nitronicotinic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the research and development of new compounds due to its unique chemical properties.

About

CAS No 7477-10-3
English Name 6-Chloro-5-nitronicotinic acid
Molecular Formula C6H3ClN2O4
Molecular Weight 202.55 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])Cl)C(=O)O
InChIKey HCRHNMXCDNACMH-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3)?

6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) is a chemical compound with the molecular formula C7...

Compound Q&A

Is 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) safe?

6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) is generally considered safe when handled with appro...

Compound Q&A

How should 6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) be stored?

6-Chloro-5-nitronicotinic acid (CAS: 7477-10-3) should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...