Compound Q&A

What is the market or research trend for [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7)?

Answer

[6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid
The market and research trends for [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) are closely linked to its applications in the pharmaceutical and biotechnology industries. There is a growing interest in using this compound for drug discovery and development. Recent research trends focus on its utility in catalytic reactions, particularly in asymmetric synthesis and in medicinal chemistry for target specific drug design. The compound's unique properties make it a valuable tool in these fields.

About

English Name [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid
Molecular Formula C10H15BN2O4
Molecular Weight 238.05 g/mol
SMILES B(C1=CN=C(C=C1)NC(=O)OC(C)(C)C)(O)O
InChIKey KAFAFKANQAGBRH-UHFFFAOYSA-N
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7)?

The compound [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20...

Compound Q&A

Are there alternatives to [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) in synthesis?

In the synthesis of compounds like [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boroni...

Compound Q&A

How should waste containing [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) be handled?

Waste containing [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 88323...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...