Compound Q&A

What regulatory guidelines apply to [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7)?

Answer

[6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid
The compound [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) is subject to various regulatory guidelines. It falls under the scope of REACH regulations in the EU, requiring Registration, Evaluation, Authorization, and Restriction of Chemicals. In the United States, it is regulated under the Toxic Substances Control Act (TSCA) by the EPA and the FDA for its use in pharmaceutical and chemical applications. Additionally, it should comply with the Globally Harmonized System of Classification and Labelling of Chemicals (GHS) for proper hazard communication and labeling.

About

English Name [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid
Molecular Formula C10H15BN2O4
Molecular Weight 238.05 g/mol
SMILES B(C1=CN=C(C=C1)NC(=O)OC(C)(C)C)(O)O
InChIKey KAFAFKANQAGBRH-UHFFFAOYSA-N
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

Are there alternatives to [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) in synthesis?

In the synthesis of compounds like [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boroni...

Compound Q&A

What is the market or research trend for [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7)?

The market and research trends for [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boroni...

Compound Q&A

How should waste containing [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 883231-20-7) be handled?

Waste containing [6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-pyridinyl]boronic acid (CAS: 88323...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...