Compound Q&A

What industries use NS 2330 (CAS: 402856-42-2)?

Answer

NS 2330
NS 2330 (CAS: 402856-42-2) is primarily used in the pharmaceutical industry for its potential as a tyrosine kinase inhibitor. It is also explored in polymer science for its reactive functional groups and in sensor technology for its specific binding properties.

About

English Name NS 2330
Molecular Formula C17H23Cl2NO
Molecular Weight 328.28 g/mol
SMILES CCOCC1C2CCC(N2C)CC1C3=CC(=C(C=C3)Cl)Cl
InChIKey VCVWXKKWDOJNIT-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of NS 2330 (CAS: 402856-42-2)?

NS 2330 (CAS: 402856-42-2) is a white crystalline solid with a molecular weight of approximately 470...

Compound Q&A

How is NS 2330 (CAS: 402856-42-2) typically synthesized?

NS 2330 (CAS: 402856-42-2) is typically synthesized via a multi-step process involving the condensat...

Compound Q&A

What precautions should be taken when handling NS 2330 (CAS: 402856-42-2)?

When handling NS 2330 (CAS: 402856-42-2), appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...