Compound Q&A

How is NS 2330 (CAS: 402856-42-2) typically synthesized?

Answer

NS 2330
NS 2330 (CAS: 402856-42-2) is typically synthesized via a multi-step process involving the condensation of a benzylamine with a substituted salicylaldehyde, followed by acetylation and cyclization. The reaction is carried out in the presence of a mild base under inert conditions to maximize yield and selectivity.

About

English Name NS 2330
Molecular Formula C17H23Cl2NO
Molecular Weight 328.28 g/mol
SMILES CCOCC1C2CCC(N2C)CC1C3=CC(=C(C=C3)Cl)Cl
InChIKey VCVWXKKWDOJNIT-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of NS 2330 (CAS: 402856-42-2)?

NS 2330 (CAS: 402856-42-2) is a white crystalline solid with a molecular weight of approximately 470...

Compound Q&A

What industries use NS 2330 (CAS: 402856-42-2)?

NS 2330 (CAS: 402856-42-2) is primarily used in the pharmaceutical industry for its potential as a t...

Compound Q&A

What precautions should be taken when handling NS 2330 (CAS: 402856-42-2)?

When handling NS 2330 (CAS: 402856-42-2), appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...