Compound Q&A

What industries use 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

Answer

1-benzyl-N,4-dimethylpiperidin-3-amine
1-Benzyl-N,4-dimethylpiperidin-3-amine is widely used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for its ability to enhance properties of polymers. Additionally, it has applications in sensors due to its chemical reactivity and stability. Its use in semiconductors is limited but ongoing research explores its potential in advanced material synthesis processes.

About

English Name 1-benzyl-N,4-dimethylpiperidin-3-amine
Molecular Formula C14H22N2
Molecular Weight 218.34 g/mol
SMILES CC1C(NC)CN(CC2=CC=CC=C2)CC1
InChIKey NVKDDQBZODSEIN-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

1-Benzyl-N,4-dimethylpiperidin-3-amine is a white to off-white crystalline solid with a molecular we...

Compound Q&A

How is 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2) typically synthesized?

1-Benzyl-N,4-dimethylpiperidin-3-amine can be synthesized via a multi-step reaction starting with be...

Compound Q&A

What precautions should be taken when handling 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

When handling 1-benzyl-N,4-dimethylpiperidin-3-amine, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...