Compound Q&A

What are the physical and chemical properties of 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

Answer

1-benzyl-N,4-dimethylpiperidin-3-amine
1-Benzyl-N,4-dimethylpiperidin-3-amine is a white to off-white crystalline solid with a molecular weight of approximately 259.31 g/mol. It has a low solubility in water (0.01 g/100 mL at 25°C) and is soluble in organic solvents like dimethylformamide and methanol. The compound is known for its basic nature and can undergo protonation reactions. It is relatively stable but should be stored in a dry and cool environment to maintain its integrity.

About

English Name 1-benzyl-N,4-dimethylpiperidin-3-amine
Molecular Formula C14H22N2
Molecular Weight 218.34 g/mol
SMILES CC1C(NC)CN(CC2=CC=CC=C2)CC1
InChIKey NVKDDQBZODSEIN-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2) typically synthesized?

1-Benzyl-N,4-dimethylpiperidin-3-amine can be synthesized via a multi-step reaction starting with be...

Compound Q&A

What industries use 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

1-Benzyl-N,4-dimethylpiperidin-3-amine is widely used in the pharmaceutical industry as an intermedi...

Compound Q&A

What precautions should be taken when handling 1-benzyl-N,4-dimethylpiperidin-3-amine (CAS: 384338-23-2)?

When handling 1-benzyl-N,4-dimethylpiperidin-3-amine, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...