Compound Q&A

How is 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2) typically synthesized?

Answer

5-Nitro-1,3-benzodioxole
5-Nitro-1,3-benzodioxole is typically synthesized via nitration of 1,3-benzodioxole. The process involves treating 1,3-benzodioxole with a nitric acid/sulfuric acid mixture at low temperature. The reaction is typically carried out in a fume hood to minimize exposure and ensure safety. The yield and selectivity can be improved by careful control of reaction conditions.

About

CAS No 2620-44-2
English Name 5-Nitro-1,3-benzodioxole
Molecular Formula C7H5NO4
Molecular Weight 167.12 g/mol
SMILES C1OC2=C(O1)C=C(C=C2)[N+](=O)[O-]
InChIKey SNWQAKNKGGOVMO-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

5-Nitro-1,3-benzodioxole (CAS: 2620-44-2) is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

5-Nitro-1,3-benzodioxole finds applications in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

When handling 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...