Compound Q&A

What are the physical and chemical properties of 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

Answer

5-Nitro-1,3-benzodioxole
5-Nitro-1,3-benzodioxole (CAS: 2620-44-2) is a white crystalline solid with a molecular weight of approximately 194.08 g/mol. It has low water solubility but is soluble in organic solvents such as ethanol and acetone. This compound is known for its high reactivity, especially towards nucleophilic substitution reactions.

About

CAS No 2620-44-2
English Name 5-Nitro-1,3-benzodioxole
Molecular Formula C7H5NO4
Molecular Weight 167.12 g/mol
SMILES C1OC2=C(O1)C=C(C=C2)[N+](=O)[O-]
InChIKey SNWQAKNKGGOVMO-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2) typically synthesized?

5-Nitro-1,3-benzodioxole is typically synthesized via nitration of 1,3-benzodioxole. The process inv...

Compound Q&A

What industries use 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

5-Nitro-1,3-benzodioxole finds applications in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2)?

When handling 5-Nitro-1,3-benzodioxole (CAS: 2620-44-2), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...