Compound Q&A

What precautions should be taken when handling 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

Answer

3-Methylbutyl pentyl phthalate
When handling 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9), it is essential to wear appropriate personal protective equipment (PPE), including safety goggles, gloves, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation of vapors. Spills should be immediately contained and cleaned up using appropriate absorbent materials. Refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions. Storage should be at room temperature away from heat sources and incompatible materials.

About

English Name 3-Methylbutyl pentyl phthalate
Molecular Formula C18H26O4
Molecular Weight 306.4 g/mol
SMILES CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCC(C)C
InChIKey MCXWUHMDAJQKBI-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is a clear, colorless liquid with a molecular weig...

Compound Q&A

How is 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) typically synthesized?

3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is usually synthesized through a esterification re...

Compound Q&A

What industries use 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is utilized in various industries, including pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...